C19H23ClN6O2 — CID 52912064
1-(2-chloro-6-methoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,3-b]pyridin-5-yl)methyl]urea (PubChem CID 52912064) has the molecular formula C19H23ClN6O2 and a molecular weight of 402.89 g/mol. Its IUPAC name is 1-(2-chloro-6-methoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,3-b]pyridin-5-yl)methyl]urea.
| Compound Name | 1-(2-chloro-6-methoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,3-b]pyridin-5-yl)methyl]urea |
|---|---|
| PubChem CID | 52912064 |
| Molecular Formula | C19H23ClN6O2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-(2-chloro-6-methoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,3-b]pyridin-5-yl)methyl]urea |
| SMILES | COc1cc(NC(=O)NCc2cc(C(C)C)c3c(n2)c(C)nn3C)cc(Cl)n1 |
| InChI | InChI=1S/C19H23ClN6O2/c1-10(2)14-6-13(22-17-11(3)25-26(4)18(14)17)9-21-19(27)23-12-7-15(20)24-16(8-12)28-5/h6-8,10H,9H2,1-5H3,(H2,21,23,24,27) |
| InChIKey | VBJHQEDFVPOUBY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|