C22H28N6O3 — CID 52912142
N-(5-hydroxy-2-adamantyl)-2-[[(3S)-oxolan-3-yl]amino]-4-pyrazol-1-ylpyrimidine-5-carboxamide (PubChem CID 52912142) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-2-[[(3S)-oxolan-3-yl]amino]-4-pyrazol-1-ylpyrimidine-5-carboxamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-2-[[(3S)-oxolan-3-yl]amino]-4-pyrazol-1-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 52912142 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-2-[[(3S)-oxolan-3-yl]amino]-4-pyrazol-1-ylpyrimidine-5-carboxamide |
| SMILES | O=C(NC1C2CC3CC1CC(O)(C3)C2)c1cnc(N[C@H]2CCOC2)nc1-n1cccn1 |
| InChI | InChI=1S/C22H28N6O3/c29-20(26-18-14-6-13-7-15(18)10-22(30,8-13)9-14)17-11-23-21(25-16-2-5-31-12-16)27-19(17)28-4-1-3-24-28/h1,3-4,11,13-16,18,30H,2,5-10,12H2,(H,26,29)(H,23,25,27)/t13?,14?,15?,16-,18?,22?/m0/s1 |
| InChIKey | SFVBKRZXJYHTPW-DNRUVQCQSA-N |
| XLogP | 1.53 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |