C28H38O4SSi — CID 52912326
S-(4-methylphenyl) (2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-6-(phenylmethoxymethyl)oxane-2-carbothioate (PubChem CID 52912326) has the molecular formula C28H38O4SSi and a molecular weight of 498.76 g/mol. Its IUPAC name is S-(4-methylphenyl) (2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-6-(phenylmethoxymethyl)oxane-2-carbothioate.
| Compound Name | S-(4-methylphenyl) (2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-6-(phenylmethoxymethyl)oxane-2-carbothioate |
|---|---|
| PubChem CID | 52912326 |
| Molecular Formula | C28H38O4SSi |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | S-(4-methylphenyl) (2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-6-(phenylmethoxymethyl)oxane-2-carbothioate |
| SMILES | C=C1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)Sc2ccc(C)cc2)O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C28H38O4SSi/c1-20-13-15-23(16-14-20)33-27(29)26-24(32-34(6,7)28(3,4)5)17-21(2)25(31-26)19-30-18-22-11-9-8-10-12-22/h8-16,24-26H,2,17-19H2,1,3-7H3/t24-,25-,26-/m0/s1 |
| InChIKey | LKHPNYFMTYBWFJ-GSDHBNRESA-N |
| XLogP | 6.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|