C35H50O6Si — CID 52912328
(3R)-1-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-6-(phenylmethoxymethyl)oxan-2-yl]-5-[(4-methoxyphenyl)methoxy]-3-methyl-2-methylidenepentan-1-one (PubChem CID 52912328) has the molecular formula C35H50O6Si and a molecular weight of 594.87 g/mol. Its IUPAC name is (3R)-1-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-6-(phenylmethoxymethyl)oxan-2-yl]-5-[(4-methoxyphenyl)methoxy]-3-methyl-2-methylidenepentan-1-one.
| Compound Name | (3R)-1-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-6-(phenylmethoxymethyl)oxan-2-yl]-5-[(4-methoxyphenyl)methoxy]-3-methyl-2-methylidenepentan-1-one |
|---|---|
| PubChem CID | 52912328 |
| Molecular Formula | C35H50O6Si |
| Molecular Weight | 594.87 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | (3R)-1-[(2S,3S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylidene-6-(phenylmethoxymethyl)oxan-2-yl]-5-[(4-methoxyphenyl)methoxy]-3-methyl-2-methylidenepentan-1-one |
| SMILES | C=C(C(=O)[C@H]1O[C@@H](COCc2ccccc2)C(=C)C[C@@H]1O[Si](C)(C)C(C)(C)C)[C@H](C)CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C35H50O6Si/c1-25(19-20-38-22-29-15-17-30(37-7)18-16-29)27(3)33(36)34-31(41-42(8,9)35(4,5)6)21-26(2)32(40-34)24-39-23-28-13-11-10-12-14-28/h10-18,25,31-32,34H,2-3,19-24H2,1,4-9H3/t25-,31+,32+,34+/m1/s1 |
| InChIKey | LQVIRPMKDGPYRY-LBDRINLVSA-N |
| XLogP | 7.68 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.87 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|