About 3-propylquinazolin-4-one
3-propylquinazolin-4-one (PubChem CID 529124) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-propylquinazolin-4-one.
Molecular Properties
| Compound Name | 3-propylquinazolin-4-one |
| PubChem CID | 529124 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3-propylquinazolin-4-one |
| SMILES | CCCn1cnc2ccccc2c1=O |
| InChI | InChI=1S/C11H12N2O/c1-2-7-13-8-12-10-6-4-3-5-9(10)11(13)14/h3-6,8H,2,7H2,1H3 |
| InChIKey | XUULXKORCSQLNN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-propylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylquinazolin-4-one?
The IUPAC name of 3-propylquinazolin-4-one (CID 529124) is 3-propylquinazolin-4-one.
What is the SMILES notation for 3-propylquinazolin-4-one?
The canonical SMILES for 3-propylquinazolin-4-one is CCCn1cnc2ccccc2c1=O.
What is the InChIKey of 3-propylquinazolin-4-one?
The InChIKey is XUULXKORCSQLNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-2-7-13-8-12-10-6-4-3-5-9(10)11(13)14/h3-6,8H,2,7H2,1H3.
What are the key properties of 3-propylquinazolin-4-one?
3-propylquinazolin-4-one has a molecular weight of 188.23 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylquinazolin-4-one is sourced from PubChem (CID 529124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).