C20H30O2 — CID 52912457
(4bS,8aS,9R)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-1,9-diol (PubChem CID 52912457) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (4bS,8aS,9R)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-1,9-diol.
| Compound Name | (4bS,8aS,9R)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-1,9-diol |
|---|---|
| PubChem CID | 52912457 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (4bS,8aS,9R)-4b,8,8-trimethyl-2-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthrene-1,9-diol |
| SMILES | CC(C)c1ccc2c(c1O)C[C@@H](O)[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C20H30O2/c1-12(2)13-7-8-15-14(17(13)22)11-16(21)18-19(3,4)9-6-10-20(15,18)5/h7-8,12,16,18,21-22H,6,9-11H2,1-5H3/t16-,18+,20-/m1/s1 |
| InChIKey | YZNPGPYMYZNIQX-IMFGXOCKSA-N |
| XLogP | 4.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |