C29H38O3Si — CID 52912520
ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-ethenylcyclopentene-1-carboxylate (PubChem CID 52912520) has the molecular formula C29H38O3Si and a molecular weight of 462.71 g/mol. Its IUPAC name is ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-ethenylcyclopentene-1-carboxylate.
| Compound Name | ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-ethenylcyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 52912520 |
| Molecular Formula | C29H38O3Si |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-ethenylcyclopentene-1-carboxylate |
| SMILES | C=CC1(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC=C1C(=O)OCC |
| InChI | InChI=1S/C29H38O3Si/c1-6-29(21-14-20-26(29)27(30)31-7-2)22-15-23-32-33(28(3,4)5,24-16-10-8-11-17-24)25-18-12-9-13-19-25/h6,8-13,16-20H,1,7,14-15,21-23H2,2-5H3 |
| InChIKey | QRCWCXHWJHIEAF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|