C31H38O4Si — CID 52912566
(3aS,5aS,8bR)-5a-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-8b-methyl-3a,5,6,7-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,4-dione (PubChem CID 52912566) has the molecular formula C31H38O4Si and a molecular weight of 502.73 g/mol. Its IUPAC name is (3aS,5aS,8bR)-5a-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-8b-methyl-3a,5,6,7-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,4-dione.
| Compound Name | (3aS,5aS,8bR)-5a-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-8b-methyl-3a,5,6,7-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,4-dione |
|---|---|
| PubChem CID | 52912566 |
| Molecular Formula | C31H38O4Si |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | (3aS,5aS,8bR)-5a-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-8b-methyl-3a,5,6,7-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,4-dione |
| SMILES | CC(C)(C)[Si](OCCC[C@]12CCC=C1[C@]1(C)COC(=O)[C@@H]1C(=O)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H38O4Si/c1-29(2,3)36(23-13-7-5-8-14-23,24-15-9-6-10-16-24)35-20-12-19-31-18-11-17-26(31)30(4)22-34-28(33)27(30)25(32)21-31/h5-10,13-17,27H,11-12,18-22H2,1-4H3/t27-,30-,31-/m0/s1 |
| InChIKey | REZOTPZBCWVWHW-NAYUSWPISA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|