C22H27NO5 — CID 52912718
N-[(2S,3R,4R,5R,6S)-5-hydroxy-6-methyl-2,4-bis(phenylmethoxy)oxan-3-yl]acetamide (PubChem CID 52912718) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R,6S)-5-hydroxy-6-methyl-2,4-bis(phenylmethoxy)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5R,6S)-5-hydroxy-6-methyl-2,4-bis(phenylmethoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 52912718 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[(2S,3R,4R,5R,6S)-5-hydroxy-6-methyl-2,4-bis(phenylmethoxy)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](OCc2ccccc2)O[C@@H](C)[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO5/c1-15-20(25)21(26-13-17-9-5-3-6-10-17)19(23-16(2)24)22(28-15)27-14-18-11-7-4-8-12-18/h3-12,15,19-22,25H,13-14H2,1-2H3,(H,23,24)/t15-,19+,20+,21+,22-/m0/s1 |
| InChIKey | KCDANQDOCTZXOU-OKXHKQLBSA-N |
| XLogP | 2.40 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |