C20H28O — CID 52912943
(4aS,10aS)-8-methoxy-4a-methyl-1-methylidene-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene (PubChem CID 52912943) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (4aS,10aS)-8-methoxy-4a-methyl-1-methylidene-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene.
| Compound Name | (4aS,10aS)-8-methoxy-4a-methyl-1-methylidene-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene |
|---|---|
| PubChem CID | 52912943 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (4aS,10aS)-8-methoxy-4a-methyl-1-methylidene-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene |
| SMILES | C=C1CCC[C@]2(C)c3ccc(C(C)C)c(OC)c3CC[C@@H]12 |
| InChI | InChI=1S/C20H28O/c1-13(2)15-8-11-18-16(19(15)21-5)9-10-17-14(3)7-6-12-20(17,18)4/h8,11,13,17H,3,6-7,9-10,12H2,1-2,4-5H3/t17-,20-/m0/s1 |
| InChIKey | LKQMSAJXAVZWMG-PXNSSMCTSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|