C14H12N4O2Se — CID 52913094
methyl N,N'-bis(pyridine-3-carbonyl)carbamimidoselenoate (PubChem CID 52913094) has the molecular formula C14H12N4O2Se and a molecular weight of 347.24 g/mol. Its IUPAC name is methyl N,N'-bis(pyridine-3-carbonyl)carbamimidoselenoate.
| Compound Name | methyl N,N'-bis(pyridine-3-carbonyl)carbamimidoselenoate |
|---|---|
| PubChem CID | 52913094 |
| Molecular Formula | C14H12N4O2Se |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | methyl N,N'-bis(pyridine-3-carbonyl)carbamimidoselenoate |
| SMILES | C[Se]/C(=N\C(=O)c1cccnc1)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C14H12N4O2Se/c1-21-14(17-12(19)10-4-2-6-15-8-10)18-13(20)11-5-3-7-16-9-11/h2-9H,1H3,(H,17,18,19,20) |
| InChIKey | GYPWUOAXYJCOOI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|