C34H36N6O4 — CID 52913211
2-N,9-N-bis[4-[2-(dimethylamino)ethoxy]phenyl]-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 52913211) has the molecular formula C34H36N6O4 and a molecular weight of 592.70 g/mol. Its IUPAC name is 2-N,9-N-bis[4-[2-(dimethylamino)ethoxy]phenyl]-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 2-N,9-N-bis[4-[2-(dimethylamino)ethoxy]phenyl]-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 52913211 |
| Molecular Formula | C34H36N6O4 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 2-N,9-N-bis[4-[2-(dimethylamino)ethoxy]phenyl]-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | CN(C)CCOc1ccc(NC(=O)c2ccc3ccc4ccc(C(=O)Nc5ccc(OCCN(C)C)cc5)nc4c3n2)cc1 |
| InChI | InChI=1S/C34H36N6O4/c1-39(2)19-21-43-27-13-9-25(10-14-27)35-33(41)29-17-7-23-5-6-24-8-18-30(38-32(24)31(23)37-29)34(42)36-26-11-15-28(16-12-26)44-22-20-40(3)4/h5-18H,19-22H2,1-4H3,(H,35,41)(H,36,42) |
| InChIKey | JYBQCVOPWQFDEA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|