C15H24Cl2N2O8Pt — CID 52913700
[(4R,5R)-5-(aminomethyl)-2-ethyl-1,3-dioxolan-4-yl]methanamine;3-(2,2-dichloroacetyl)oxycyclobutane-1,1-dicarboxylic acid;platinum (PubChem CID 52913700) has the molecular formula C15H24Cl2N2O8Pt and a molecular weight of 626.35 g/mol. Its IUPAC name is [(4R,5R)-5-(aminomethyl)-2-ethyl-1,3-dioxolan-4-yl]methanamine;3-(2,2-dichloroacetyl)oxycyclobutane-1,1-dicarboxylic acid;platinum.
| Compound Name | [(4R,5R)-5-(aminomethyl)-2-ethyl-1,3-dioxolan-4-yl]methanamine;3-(2,2-dichloroacetyl)oxycyclobutane-1,1-dicarboxylic acid;platinum |
|---|---|
| PubChem CID | 52913700 |
| Molecular Formula | C15H24Cl2N2O8Pt |
| Molecular Weight | 626.35 g/mol |
| Exact Mass | 625.06 |
| IUPAC Name | [(4R,5R)-5-(aminomethyl)-2-ethyl-1,3-dioxolan-4-yl]methanamine;3-(2,2-dichloroacetyl)oxycyclobutane-1,1-dicarboxylic acid;platinum |
| SMILES | CCC1O[C@H](CN)[C@@H](CN)O1.O=C(OC1CC(C(=O)O)(C(=O)O)C1)C(Cl)Cl.[Pt] |
| InChI | InChI=1S/C8H8Cl2O6.C7H16N2O2.Pt/c9-4(10)5(11)16-3-1-8(2-3,6(12)13)7(14)15;1-2-7-10-5(3-8)6(4-9)11-7;/h3-4H,1-2H2,(H,12,13)(H,14,15);5-7H,2-4,8-9H2,1H3;/t;5-,6-;/m.1./s1 |
| InChIKey | CSTVCJCGQBANKE-JGHXHLRYSA-N |
| XLogP | 0.07 |
| TPSA | 171.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|