C17H26O2 — CID 52914007
(E,3R,10S)-heptadec-8-en-4,6-diyne-3,10-diol (PubChem CID 52914007) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (E,3R,10S)-heptadec-8-en-4,6-diyne-3,10-diol.
| Compound Name | (E,3R,10S)-heptadec-8-en-4,6-diyne-3,10-diol |
|---|---|
| PubChem CID | 52914007 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (E,3R,10S)-heptadec-8-en-4,6-diyne-3,10-diol |
| SMILES | CCCCCCC[C@H](O)/C=C/C#CC#C[C@H](O)CC |
| InChI | InChI=1S/C17H26O2/c1-3-5-6-7-11-14-17(19)15-12-9-8-10-13-16(18)4-2/h12,15-19H,3-7,11,14H2,1-2H3/b15-12+/t16-,17+/m1/s1 |
| InChIKey | VPAZVTJVMAHSHH-ODQHEUEKSA-N |
| XLogP | 3.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|