About 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid
6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid (PubChem CID 52914075) has the molecular formula C18H15NO5S2
and a molecular weight of 389.45 g/mol. Its IUPAC name is 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid.
Molecular Properties
| Compound Name | 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid |
| PubChem CID | 52914075 |
| Molecular Formula | C18H15NO5S2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid |
| SMILES | COc1c(-c2ccns2)ccc(CS(=O)(=O)c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C18H15NO5S2/c1-24-17-14(15-9-10-19-25-15)8-7-12(16(17)18(20)21)11-26(22,23)13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,20,21) |
| InChIKey | VVAJQBZKNHIDEX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid?
The IUPAC name of 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid (CID 52914075) is 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid.
What is the SMILES notation for 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid?
The canonical SMILES for 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid is COc1c(-c2ccns2)ccc(CS(=O)(=O)c2ccccc2)c1C(=O)O.
What is the InChIKey of 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid?
The InChIKey is VVAJQBZKNHIDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO5S2/c1-24-17-14(15-9-10-19-25-15)8-7-12(16(17)18(20)21)11-26(22,23)13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,20,21).
What are the key properties of 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid?
6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid has a molecular weight of 389.45 g/mol, XLogP of 3.49, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(benzenesulfonylmethyl)-2-methoxy-3-(1,2-thiazol-5-yl)benzoic acid is sourced from PubChem (CID 52914075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).