C16H17N5 — CID 52914122
7-methyl-3-[(1R)-1-phenylethyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 52914122) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 7-methyl-3-[(1R)-1-phenylethyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 7-methyl-3-[(1R)-1-phenylethyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 52914122 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 7-methyl-3-[(1R)-1-phenylethyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | Cc1nc2ncnn2c2c1CCN2[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H17N5/c1-11-14-8-9-20(12(2)13-6-4-3-5-7-13)15(14)21-16(19-11)17-10-18-21/h3-7,10,12H,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | KLHJCRXZKQLXFF-GFCCVEGCSA-N |
| XLogP | 2.56 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |