C21H24FNO6 — CID 52914393
(2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 52914393) has the molecular formula C21H24FNO6 and a molecular weight of 405.42 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 52914393 |
| Molecular Formula | C21H24FNO6 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(F)c(Cc3ccc4c(c3)NCCO4)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H24FNO6/c22-14-3-2-12(21-20(27)19(26)18(25)17(10-24)29-21)9-13(14)7-11-1-4-16-15(8-11)23-5-6-28-16/h1-4,8-9,17-21,23-27H,5-7,10H2/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | DVKUSDXNSFOFKS-ADAARDCZSA-N |
| XLogP | 0.74 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |