C39H34N8O5 — CID 52914543
2-[[4-amino-3-(3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-3-(1-benzofuran-5-ylmethyl)-5-(6-morpholin-4-yl-6-oxohex-1-ynyl)quinazolin-4-one (PubChem CID 52914543) has the molecular formula C39H34N8O5 and a molecular weight of 694.75 g/mol. Its IUPAC name is 2-[[4-amino-3-(3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-3-(1-benzofuran-5-ylmethyl)-5-(6-morpholin-4-yl-6-oxohex-1-ynyl)quinazolin-4-one.
| Compound Name | 2-[[4-amino-3-(3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-3-(1-benzofuran-5-ylmethyl)-5-(6-morpholin-4-yl-6-oxohex-1-ynyl)quinazolin-4-one |
|---|---|
| PubChem CID | 52914543 |
| Molecular Formula | C39H34N8O5 |
| Molecular Weight | 694.75 g/mol |
| Exact Mass | 694.27 |
| IUPAC Name | 2-[[4-amino-3-(3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-3-(1-benzofuran-5-ylmethyl)-5-(6-morpholin-4-yl-6-oxohex-1-ynyl)quinazolin-4-one |
| SMILES | Nc1ncnc2c1c(-c1cccc(O)c1)nn2Cc1nc2cccc(C#CCCCC(=O)N3CCOCC3)c2c(=O)n1Cc1ccc2occc2c1 |
| InChI | InChI=1S/C39H34N8O5/c40-37-35-36(28-8-4-9-29(48)21-28)44-47(38(35)42-24-41-37)23-32-43-30-10-5-7-26(6-2-1-3-11-33(49)45-15-18-51-19-16-45)34(30)39(50)46(32)22-25-12-13-31-27(20-25)14-17-52-31/h4-5,7-10,12-14,17,20-21,24,48H,1,3,11,15-16,18-19,22-23H2,(H2,40,41,42) |
| InChIKey | FAPNBNUTFBHNBO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 167.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.75 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|