About 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one
2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one (PubChem CID 5291469) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one.
Molecular Properties
| Compound Name | 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one |
| PubChem CID | 5291469 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one |
| SMILES | Cc1ccc2c(c1)/C(=C/c1nc3ccccc3c(=O)n1C)C(=O)N2C |
| InChI | InChI=1S/C20H17N3O2/c1-12-8-9-17-14(10-12)15(20(25)22(17)2)11-18-21-16-7-5-4-6-13(16)19(24)23(18)3/h4-11H,1-3H3/b15-11- |
| InChIKey | XXQVNQSZSZBWAO-PTNGSMBKSA-N |
| XLogP | 2.76 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one?
The IUPAC name of 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one (CID 5291469) is 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one.
What is the SMILES notation for 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one?
The canonical SMILES for 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one is Cc1ccc2c(c1)/C(=C/c1nc3ccccc3c(=O)n1C)C(=O)N2C.
What is the InChIKey of 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one?
The InChIKey is XXQVNQSZSZBWAO-PTNGSMBKSA-N. The full InChI is InChI=1S/C20H17N3O2/c1-12-8-9-17-14(10-12)15(20(25)22(17)2)11-18-21-16-7-5-4-6-13(16)19(24)23(18)3/h4-11H,1-3H3/b15-11-.
What are the key properties of 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one?
2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one has a molecular weight of 331.38 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-(1,5-dimethyl-2-oxoindol-3-ylidene)methyl]-3-methylquinazolin-4-one is sourced from PubChem (CID 5291469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).