C40H44N6O4 — CID 52914803
2-N,9-N-bis[4-(2-piperidin-1-ylethoxy)phenyl]-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 52914803) has the molecular formula C40H44N6O4 and a molecular weight of 672.83 g/mol. Its IUPAC name is 2-N,9-N-bis[4-(2-piperidin-1-ylethoxy)phenyl]-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 2-N,9-N-bis[4-(2-piperidin-1-ylethoxy)phenyl]-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 52914803 |
| Molecular Formula | C40H44N6O4 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | 2-N,9-N-bis[4-(2-piperidin-1-ylethoxy)phenyl]-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | O=C(Nc1ccc(OCCN2CCCCC2)cc1)c1ccc2ccc3ccc(C(=O)Nc4ccc(OCCN5CCCCC5)cc4)nc3c2n1 |
| InChI | InChI=1S/C40H44N6O4/c47-39(41-31-11-15-33(16-12-31)49-27-25-45-21-3-1-4-22-45)35-19-9-29-7-8-30-10-20-36(44-38(30)37(29)43-35)40(48)42-32-13-17-34(18-14-32)50-28-26-46-23-5-2-6-24-46/h7-20H,1-6,21-28H2,(H,41,47)(H,42,48) |
| InChIKey | SVXMTKHVKFOUQU-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|