C38H40N6O4 — CID 52914804
2-N,9-N-bis[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 52914804) has the molecular formula C38H40N6O4 and a molecular weight of 644.78 g/mol. Its IUPAC name is 2-N,9-N-bis[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 2-N,9-N-bis[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 52914804 |
| Molecular Formula | C38H40N6O4 |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | 2-N,9-N-bis[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | O=C(Nc1ccc(OCCN2CCCC2)cc1)c1ccc2ccc3ccc(C(=O)Nc4ccc(OCCN5CCCC5)cc4)nc3c2n1 |
| InChI | InChI=1S/C38H40N6O4/c45-37(39-29-9-13-31(14-10-29)47-25-23-43-19-1-2-20-43)33-17-7-27-5-6-28-8-18-34(42-36(28)35(27)41-33)38(46)40-30-11-15-32(16-12-30)48-26-24-44-21-3-4-22-44/h5-18H,1-4,19-26H2,(H,39,45)(H,40,46) |
| InChIKey | SBFOAHZFNBRPAE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|