C30H22NO5+ — CID 52915237
(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) naphthalene-2-carboxylate (PubChem CID 52915237) has the molecular formula C30H22NO5+ and a molecular weight of 476.51 g/mol. Its IUPAC name is (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) naphthalene-2-carboxylate.
| Compound Name | (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 52915237 |
| Molecular Formula | C30H22NO5+ |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | (17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl) naphthalene-2-carboxylate |
| SMILES | COc1ccc2cc3[n+](cc2c1OC(=O)c1ccc2ccccc2c1)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C30H22NO5/c1-33-26-9-8-20-13-25-23-15-28-27(34-17-35-28)14-21(23)10-11-31(25)16-24(20)29(26)36-30(32)22-7-6-18-4-2-3-5-19(18)12-22/h2-9,12-16H,10-11,17H2,1H3/q+1 |
| InChIKey | UGKHHOBLFDOSPS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|