C18H25NO3 — CID 52915280
(E)-N-(4-tert-butylphenyl)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]prop-2-enamide (PubChem CID 52915280) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (E)-N-(4-tert-butylphenyl)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]prop-2-enamide.
| Compound Name | (E)-N-(4-tert-butylphenyl)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 52915280 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (E)-N-(4-tert-butylphenyl)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)/C=C/C2C[C@@H](O)[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C18H25NO3/c1-18(2,3)13-5-7-14(8-6-13)19-17(22)9-4-12-10-15(20)16(21)11-12/h4-9,12,15-16,20-21H,10-11H2,1-3H3,(H,19,22)/b9-4+/t12?,15-,16+ |
| InChIKey | YRHFVXAOXCLHRN-VJTWLAMBSA-N |
| XLogP | 2.61 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|