C23H27BrN2 — CID 52915414
7-bromo-N-methyl-N-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methyl]-9H-fluoren-2-amine (PubChem CID 52915414) has the molecular formula C23H27BrN2 and a molecular weight of 411.39 g/mol. Its IUPAC name is 7-bromo-N-methyl-N-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methyl]-9H-fluoren-2-amine.
| Compound Name | 7-bromo-N-methyl-N-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methyl]-9H-fluoren-2-amine |
|---|---|
| PubChem CID | 52915414 |
| Molecular Formula | C23H27BrN2 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 7-bromo-N-methyl-N-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methyl]-9H-fluoren-2-amine |
| SMILES | CN(CC1=CC(C)(C)NC1(C)C)c1ccc2c(c1)Cc1cc(Br)ccc1-2 |
| InChI | InChI=1S/C23H27BrN2/c1-22(2)13-17(23(3,4)25-22)14-26(5)19-7-9-21-16(12-19)10-15-11-18(24)6-8-20(15)21/h6-9,11-13,25H,10,14H2,1-5H3 |
| InChIKey | RNVXLCANIQYYNF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|