C13H17NOS — CID 52915613
7-propoxy-1,3,4,5-tetrahydro-1-benzazepine-2-thione (PubChem CID 52915613) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 7-propoxy-1,3,4,5-tetrahydro-1-benzazepine-2-thione.
| Compound Name | 7-propoxy-1,3,4,5-tetrahydro-1-benzazepine-2-thione |
|---|---|
| PubChem CID | 52915613 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 7-propoxy-1,3,4,5-tetrahydro-1-benzazepine-2-thione |
| SMILES | CCCOc1ccc2c(c1)CCCC(=S)N2 |
| InChI | InChI=1S/C13H17NOS/c1-2-8-15-11-6-7-12-10(9-11)4-3-5-13(16)14-12/h6-7,9H,2-5,8H2,1H3,(H,14,16) |
| InChIKey | SZTTUPLNRNNPMB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|