C11H16N2O2 — CID 52915934
(3S,4R)-3,4-dideuterio-3-(1,1,2,2,2-pentadeuterioethyl)-4-[[3-(trideuteriomethyl)imidazol-4-yl]methyl]oxolan-2-one (PubChem CID 52915934) has the molecular formula C11H16N2O2 and a molecular weight of 218.32 g/mol. Its IUPAC name is (3S,4R)-3,4-dideuterio-3-(1,1,2,2,2-pentadeuterioethyl)-4-[[3-(trideuteriomethyl)imidazol-4-yl]methyl]oxolan-2-one.
| Compound Name | (3S,4R)-3,4-dideuterio-3-(1,1,2,2,2-pentadeuterioethyl)-4-[[3-(trideuteriomethyl)imidazol-4-yl]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 52915934 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (3S,4R)-3,4-dideuterio-3-(1,1,2,2,2-pentadeuterioethyl)-4-[[3-(trideuteriomethyl)imidazol-4-yl]methyl]oxolan-2-one |
| SMILES | [2H]C([2H])([2H])n1cncc1C[C@@]1([2H])COC(=O)[C@@]1([2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10-/m0/s1/i1D3,2D3,3D2,8D,10D |
| InChIKey | QCHFTSOMWOSFHM-ALPDLHOQSA-N |
| XLogP | 1.16 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |