About 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine
3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine (PubChem CID 52915984) has the molecular formula C15H15N3O3S2
and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 52915984 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(C)n2nc(S(C)=O)c(S(=O)(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C15H15N3O3S2/c1-10-9-11(2)18-14(16-10)13(15(17-18)22(3)19)23(20,21)12-7-5-4-6-8-12/h4-9H,1-3H3 |
| InChIKey | WRKUKFHEVGZXKW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine (CID 52915984) is 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine is Cc1cc(C)n2nc(S(C)=O)c(S(=O)(=O)c3ccccc3)c2n1.
What is the InChIKey of 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine?
The InChIKey is WRKUKFHEVGZXKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O3S2/c1-10-9-11(2)18-14(16-10)13(15(17-18)22(3)19)23(20,21)12-7-5-4-6-8-12/h4-9H,1-3H3.
What are the key properties of 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine?
3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine has a molecular weight of 349.44 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-5,7-dimethyl-2-methylsulfinylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 52915984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).