C21H28N6O6 — CID 52915994
(2S,3S,4S,5R)-2-[[[2-[2-(3,4-dimethoxyphenyl)ethylamino]-7H-purin-6-yl]amino]methyl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 52915994) has the molecular formula C21H28N6O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-[[[2-[2-(3,4-dimethoxyphenyl)ethylamino]-7H-purin-6-yl]amino]methyl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-[[[2-[2-(3,4-dimethoxyphenyl)ethylamino]-7H-purin-6-yl]amino]methyl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 52915994 |
| Molecular Formula | C21H28N6O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (2S,3S,4S,5R)-2-[[[2-[2-(3,4-dimethoxyphenyl)ethylamino]-7H-purin-6-yl]amino]methyl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COc1ccc(CCNc2nc(NC[C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3O)c3[nH]cnc3n2)cc1OC |
| InChI | InChI=1S/C21H28N6O6/c1-31-12-4-3-11(7-13(12)32-2)5-6-22-21-26-19(16-20(27-21)25-10-24-16)23-8-14-17(29)18(30)15(9-28)33-14/h3-4,7,10,14-15,17-18,28-30H,5-6,8-9H2,1-2H3,(H3,22,23,24,25,26,27)/t14-,15+,17+,18+/m0/s1 |
| InChIKey | FBMHOORGXBWVCG-BURFUSLBSA-N |
| XLogP | -0.08 |
| TPSA | 166.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |