C24H22N6OS2 — CID 52916069
16-[4-(2-ethoxyethylsulfanyl)pyrazolo[5,4-d]pyrimidin-1-yl]-14-methyl-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12,14,16-heptaene (PubChem CID 52916069) has the molecular formula C24H22N6OS2 and a molecular weight of 474.62 g/mol. Its IUPAC name is 16-[4-(2-ethoxyethylsulfanyl)pyrazolo[5,4-d]pyrimidin-1-yl]-14-methyl-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12,14,16-heptaene.
| Compound Name | 16-[4-(2-ethoxyethylsulfanyl)pyrazolo[5,4-d]pyrimidin-1-yl]-14-methyl-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12,14,16-heptaene |
|---|---|
| PubChem CID | 52916069 |
| Molecular Formula | C24H22N6OS2 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 16-[4-(2-ethoxyethylsulfanyl)pyrazolo[5,4-d]pyrimidin-1-yl]-14-methyl-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12,14,16-heptaene |
| SMILES | CCOCCSc1ncnc2c1cnn2-c1nc(C)nc2sc3c(c12)-c1ccccc1CC3 |
| InChI | InChI=1S/C24H22N6OS2/c1-3-31-10-11-32-23-17-12-27-30(21(17)25-13-26-23)22-20-19-16-7-5-4-6-15(16)8-9-18(19)33-24(20)29-14(2)28-22/h4-7,12-13H,3,8-11H2,1-2H3 |
| InChIKey | RIKXIGBNQWHYBZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|