C23H24O5 — CID 52916109
6-hydroxy-17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione (PubChem CID 52916109) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is 6-hydroxy-17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione.
| Compound Name | 6-hydroxy-17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione |
|---|---|
| PubChem CID | 52916109 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 6-hydroxy-17,17-dimethyl-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione |
| SMILES | CC(C)=CCC12OC(C)(C)C3CC(C=C4C(=O)c5ccc(O)cc5OC431)C2=O |
| InChI | InChI=1S/C23H24O5/c1-12(2)7-8-22-20(26)13-9-16-19(25)15-6-5-14(24)11-17(15)27-23(16,22)18(10-13)21(3,4)28-22/h5-7,9,11,13,18,24H,8,10H2,1-4H3 |
| InChIKey | VLADFNOTLYCWMW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|