C11H18O4 — CID 52916185
ethyl (3aS,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxylate (PubChem CID 52916185) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl (3aS,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxylate.
| Compound Name | ethyl (3aS,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxylate |
|---|---|
| PubChem CID | 52916185 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethyl (3aS,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-5-carboxylate |
| SMILES | CCOC(=O)C1C[C@@H]2[C@H](C1)OC(O2)(C)C |
| InChI | InChI=1S/C11H18O4/c1-4-13-10(12)7-5-8-9(6-7)15-11(2,3)14-8/h7-9H,4-6H2,1-3H3/t7?,8-,9+ |
| InChIKey | PMZMWENQFWHBDS-CBLAIPOGSA-N |
| XLogP | 1.30 |
| TPSA | 44.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | 245 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |