About cis-(1S,2R)-4-propylcyclopentane-1,2-diol
cis-(1S,2R)-4-propylcyclopentane-1,2-diol (PubChem CID 52916274) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is cis-(1S,2R)-4-propylcyclopentane-1,2-diol.
Molecular Properties
| Compound Name | cis-(1S,2R)-4-propylcyclopentane-1,2-diol |
| PubChem CID | 52916274 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | cis-(1S,2R)-4-propylcyclopentane-1,2-diol |
| SMILES | CCCC1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C8H16O2/c1-2-3-6-4-7(9)8(10)5-6/h6-10H,2-5H2,1H3/t6?,7-,8+ |
| InChIKey | MPZCNPVCHBVCCW-IEESLHIDSA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,2R)-4-propylcyclopentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-4-propylcyclopentane-1,2-diol?
The IUPAC name of cis-(1S,2R)-4-propylcyclopentane-1,2-diol (CID 52916274) is cis-(1S,2R)-4-propylcyclopentane-1,2-diol.
What is the SMILES notation for cis-(1S,2R)-4-propylcyclopentane-1,2-diol?
The canonical SMILES for cis-(1S,2R)-4-propylcyclopentane-1,2-diol is CCCC1C[C@@H](O)[C@@H](O)C1.
What is the InChIKey of cis-(1S,2R)-4-propylcyclopentane-1,2-diol?
The InChIKey is MPZCNPVCHBVCCW-IEESLHIDSA-N. The full InChI is InChI=1S/C8H16O2/c1-2-3-6-4-7(9)8(10)5-6/h6-10H,2-5H2,1H3/t6?,7-,8+.
What are the key properties of cis-(1S,2R)-4-propylcyclopentane-1,2-diol?
cis-(1S,2R)-4-propylcyclopentane-1,2-diol has a molecular weight of 144.21 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-4-propylcyclopentane-1,2-diol is sourced from PubChem (CID 52916274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).