About cis-(1R,2S)-4-hexylcyclopentane-1,2-diol
cis-(1R,2S)-4-hexylcyclopentane-1,2-diol (PubChem CID 52916276) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is cis-(1R,2S)-4-hexylcyclopentane-1,2-diol.
Molecular Properties
| Compound Name | cis-(1R,2S)-4-hexylcyclopentane-1,2-diol |
| PubChem CID | 52916276 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | cis-(1R,2S)-4-hexylcyclopentane-1,2-diol |
| SMILES | CCCCCCC1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H22O2/c1-2-3-4-5-6-9-7-10(12)11(13)8-9/h9-13H,2-8H2,1H3/t9?,10-,11+ |
| InChIKey | MOUJKBRSJPKGSV-FGWVZKOKSA-N |
| XLogP | 2.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2S)-4-hexylcyclopentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-4-hexylcyclopentane-1,2-diol?
The IUPAC name of cis-(1R,2S)-4-hexylcyclopentane-1,2-diol (CID 52916276) is cis-(1R,2S)-4-hexylcyclopentane-1,2-diol.
What is the SMILES notation for cis-(1R,2S)-4-hexylcyclopentane-1,2-diol?
The canonical SMILES for cis-(1R,2S)-4-hexylcyclopentane-1,2-diol is CCCCCCC1C[C@@H](O)[C@@H](O)C1.
What is the InChIKey of cis-(1R,2S)-4-hexylcyclopentane-1,2-diol?
The InChIKey is MOUJKBRSJPKGSV-FGWVZKOKSA-N. The full InChI is InChI=1S/C11H22O2/c1-2-3-4-5-6-9-7-10(12)11(13)8-9/h9-13H,2-8H2,1H3/t9?,10-,11+.
What are the key properties of cis-(1R,2S)-4-hexylcyclopentane-1,2-diol?
cis-(1R,2S)-4-hexylcyclopentane-1,2-diol has a molecular weight of 186.29 g/mol, XLogP of 2.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-4-hexylcyclopentane-1,2-diol is sourced from PubChem (CID 52916276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).