C10H16O4 — CID 52916277
ethyl (E)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]prop-2-enoate (PubChem CID 52916277) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is ethyl (E)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]prop-2-enoate |
|---|---|
| PubChem CID | 52916277 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | ethyl (E)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H16O4/c1-2-14-10(13)4-3-7-5-8(11)9(12)6-7/h3-4,7-9,11-12H,2,5-6H2,1H3/b4-3+/t7?,8-,9+ |
| InChIKey | FXSSBUMAZONDGC-KWKLZRKESA-N |
| XLogP | 0.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|