C19H14F6O7 — CID 52916396
[(1S,2R,6R,8S,9S)-4-[3,5-bis(trifluoromethyl)phenyl]-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylprop-2-enoate (PubChem CID 52916396) has the molecular formula C19H14F6O7 and a molecular weight of 468.30 g/mol. Its IUPAC name is [(1S,2R,6R,8S,9S)-4-[3,5-bis(trifluoromethyl)phenyl]-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylprop-2-enoate.
| Compound Name | [(1S,2R,6R,8S,9S)-4-[3,5-bis(trifluoromethyl)phenyl]-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 52916396 |
| Molecular Formula | C19H14F6O7 |
| Molecular Weight | 468.30 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | [(1S,2R,6R,8S,9S)-4-[3,5-bis(trifluoromethyl)phenyl]-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@@H]1C(=O)O[C@@H]2[C@H]3OC(c4cc(C(F)(F)F)cc(C(F)(F)F)c4)O[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C19H14F6O7/c1-6(2)14(26)29-12-10-11(28-15(12)27)13-17(30-10)32-16(31-13)7-3-8(18(20,21)22)5-9(4-7)19(23,24)25/h3-5,10-13,16-17H,1H2,2H3/t10-,11-,12-,13+,16?,17+/m0/s1 |
| InChIKey | DGZIEBVHDCIWJY-VIWOVUSQSA-N |
| XLogP | 3.28 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|