C18H19N3O7 — CID 52916570
[(2S,3S,4R,5R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-4,5-dihydroxyoxan-3-yl] acetate (PubChem CID 52916570) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-4,5-dihydroxyoxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-4,5-dihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 52916570 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | [(2S,3S,4R,5R)-2-(4-benzamido-2-oxopyrimidin-1-yl)-4,5-dihydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O)[C@H](O)CO[C@@H]1n1ccc(NC(=O)c2ccccc2)nc1=O |
| InChI | InChI=1S/C18H19N3O7/c1-10(22)28-15-14(24)12(23)9-27-17(15)21-8-7-13(20-18(21)26)19-16(25)11-5-3-2-4-6-11/h2-8,12,14-15,17,23-24H,9H2,1H3,(H,19,20,25,26)/t12-,14-,15+,17+/m1/s1 |
| InChIKey | ANQLSNYSFATXNP-UTXMOHQDSA-N |
| XLogP | -0.32 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |