C17H20O4 — CID 52916604
phenyl (E)-3-[(3aS,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-yl]prop-2-enoate (PubChem CID 52916604) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is phenyl (E)-3-[(3aS,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-yl]prop-2-enoate.
| Compound Name | phenyl (E)-3-[(3aS,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 52916604 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | phenyl (E)-3-[(3aS,6aR)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-5-yl]prop-2-enoate |
| SMILES | CC1(C)O[C@H]2CC(/C=C/C(=O)Oc3ccccc3)C[C@H]2O1 |
| InChI | InChI=1S/C17H20O4/c1-17(2)20-14-10-12(11-15(14)21-17)8-9-16(18)19-13-6-4-3-5-7-13/h3-9,12,14-15H,10-11H2,1-2H3/b9-8+/t12?,14-,15+ |
| InChIKey | UHUDAWMPZVJMHE-BBXGLHRYSA-N |
| XLogP | 3.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|