About 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one
2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one (PubChem CID 52916659) has the molecular formula C17H9BrN4OS
and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one.
Molecular Properties
| Compound Name | 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one |
| PubChem CID | 52916659 |
| Molecular Formula | C17H9BrN4OS |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one |
| SMILES | O=c1c2cnc3ccc(Br)cc3c2[nH]n1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H9BrN4OS/c18-9-5-6-12-10(7-9)15-11(8-19-12)16(23)22(21-15)17-20-13-3-1-2-4-14(13)24-17/h1-8,21H |
| InChIKey | NGUGSVBBHATPRY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one?
The IUPAC name of 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one (CID 52916659) is 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one.
What is the SMILES notation for 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one?
The canonical SMILES for 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one is O=c1c2cnc3ccc(Br)cc3c2[nH]n1-c1nc2ccccc2s1.
What is the InChIKey of 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one?
The InChIKey is NGUGSVBBHATPRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9BrN4OS/c18-9-5-6-12-10(7-9)15-11(8-19-12)16(23)22(21-15)17-20-13-3-1-2-4-14(13)24-17/h1-8,21H.
What are the key properties of 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one?
2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one has a molecular weight of 397.26 g/mol, XLogP of 4.24, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-2-yl)-8-bromo-1H-pyrazolo[4,3-c]quinolin-3-one is sourced from PubChem (CID 52916659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).