C21H24N4O4S2 — CID 5291668
(5Z)-5-[[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one (PubChem CID 5291668) has the molecular formula C21H24N4O4S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (5Z)-5-[[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5291668 |
| Molecular Formula | C21H24N4O4S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (5Z)-5-[[3-ethoxy-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-imino-3-(1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(OCCN3CCOCC3)c(OCC)c2)C(=O)N1c1nccs1 |
| InChI | InChI=1S/C21H24N4O4S2/c1-2-28-17-13-15(3-4-16(17)29-11-8-24-6-9-27-10-7-24)14-18-19(26)25(20(22)31-18)21-23-5-12-30-21/h3-5,12-14,22H,2,6-11H2,1H3/b18-14-,22-20- |
| InChIKey | WHLGNMPSQJSTAT-JHRGVAJVSA-N |
| XLogP | 3.31 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|