C10H17NO3 — CID 52916723
(E)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]-N,N-dimethylprop-2-enamide (PubChem CID 52916723) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (E)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 52916723 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (E)-3-[(3R,4S)-3,4-dihydroxycyclopentyl]-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C/C1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H17NO3/c1-11(2)10(14)4-3-7-5-8(12)9(13)6-7/h3-4,7-9,12-13H,5-6H2,1-2H3/b4-3+/t7?,8-,9+ |
| InChIKey | JKAUNQDOSYCYLD-KWKLZRKESA-N |
| XLogP | -0.24 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|