C24H26N4O — CID 52917162
[2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylnaphthalen-1-yl)methanone (PubChem CID 52917162) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylnaphthalen-1-yl)methanone.
| Compound Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylnaphthalen-1-yl)methanone |
|---|---|
| PubChem CID | 52917162 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-methylnaphthalen-1-yl)methanone |
| SMILES | Cc1cc(C)nc(N2CC3CN(C(=O)c4c(C)ccc5ccccc45)CC3C2)n1 |
| InChI | InChI=1S/C24H26N4O/c1-15-8-9-18-6-4-5-7-21(18)22(15)23(29)27-11-19-13-28(14-20(19)12-27)24-25-16(2)10-17(3)26-24/h4-10,19-20H,11-14H2,1-3H3 |
| InChIKey | GHWSJSKICINIOU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |