C24H23FN4O — CID 52917164
[2-(3-fluorophenyl)phenyl]-[2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 52917164) has the molecular formula C24H23FN4O and a molecular weight of 402.47 g/mol. Its IUPAC name is [2-(3-fluorophenyl)phenyl]-[2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | [2-(3-fluorophenyl)phenyl]-[2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 52917164 |
| Molecular Formula | C24H23FN4O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [2-(3-fluorophenyl)phenyl]-[2-(4-methylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1ccnc(N2CC3CN(C(=O)c4ccccc4-c4cccc(F)c4)CC3C2)n1 |
| InChI | InChI=1S/C24H23FN4O/c1-16-9-10-26-24(27-16)29-14-18-12-28(13-19(18)15-29)23(30)22-8-3-2-7-21(22)17-5-4-6-20(25)11-17/h2-11,18-19H,12-15H2,1H3 |
| InChIKey | GDYPZYXSMGJUAS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |