C23H19FN4O3S — CID 52917504
1-(4-fluorophenyl)-N-[1-(2-methylsulfonyl-4-pyridinyl)cyclopropyl]indazole-4-carboxamide (PubChem CID 52917504) has the molecular formula C23H19FN4O3S and a molecular weight of 450.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[1-(2-methylsulfonyl-4-pyridinyl)cyclopropyl]indazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[1-(2-methylsulfonyl-4-pyridinyl)cyclopropyl]indazole-4-carboxamide |
|---|---|
| PubChem CID | 52917504 |
| Molecular Formula | C23H19FN4O3S |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[1-(2-methylsulfonyl-4-pyridinyl)cyclopropyl]indazole-4-carboxamide |
| SMILES | CS(=O)(=O)c1cc(C2(NC(=O)c3cccc4c3cnn4-c3ccc(F)cc3)CC2)ccn1 |
| InChI | InChI=1S/C23H19FN4O3S/c1-32(30,31)21-13-15(9-12-25-21)23(10-11-23)27-22(29)18-3-2-4-20-19(18)14-26-28(20)17-7-5-16(24)6-8-17/h2-9,12-14H,10-11H2,1H3,(H,27,29) |
| InChIKey | CHIPAOINOPBYSN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |