C25H28N8O2 — CID 52917607
5-[5-[(4-methoxyphenyl)methyl]-10-morpholin-4-yl-1,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]pyrimidin-2-amine (PubChem CID 52917607) has the molecular formula C25H28N8O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 5-[5-[(4-methoxyphenyl)methyl]-10-morpholin-4-yl-1,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]pyrimidin-2-amine.
| Compound Name | 5-[5-[(4-methoxyphenyl)methyl]-10-morpholin-4-yl-1,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 52917607 |
| Molecular Formula | C25H28N8O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 5-[5-[(4-methoxyphenyl)methyl]-10-morpholin-4-yl-1,5,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraen-12-yl]pyrimidin-2-amine |
| SMILES | COc1ccc(CN2CCc3c(nc4c(N5CCOCC5)nc(-c5cnc(N)nc5)cn34)C2)cc1 |
| InChI | InChI=1S/C25H28N8O2/c1-34-19-4-2-17(3-5-19)14-31-7-6-22-21(15-31)30-24-23(32-8-10-35-11-9-32)29-20(16-33(22)24)18-12-27-25(26)28-13-18/h2-5,12-13,16H,6-11,14-15H2,1H3,(H2,26,27,28) |
| InChIKey | XSCRSPVRNPIYMF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |