C14H19NO6 — CID 52917779
ethyl (3aR,7S,7aS)-7-acetamido-2,2-dimethyl-6-oxo-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate (PubChem CID 52917779) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl (3aR,7S,7aS)-7-acetamido-2,2-dimethyl-6-oxo-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aR,7S,7aS)-7-acetamido-2,2-dimethyl-6-oxo-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 52917779 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | ethyl (3aR,7S,7aS)-7-acetamido-2,2-dimethyl-6-oxo-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)C1=CC(=O)[C@@H](NC(C)=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H19NO6/c1-5-19-13(18)8-6-9(17)10(15-7(2)16)12-11(8)20-14(3,4)21-12/h6,10-12H,5H2,1-4H3,(H,15,16)/t10-,11-,12+/m1/s1 |
| InChIKey | BVLZCVFBNYCDKK-UTUOFQBUSA-N |
| XLogP | 0.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |