C12H6F4O4 — CID 52918191
5,6,7,8-tetrafluoro-2,3-dimethoxynaphthalene-1,4-dione (PubChem CID 52918191) has the molecular formula C12H6F4O4 and a molecular weight of 290.17 g/mol. Its IUPAC name is 5,6,7,8-tetrafluoro-2,3-dimethoxynaphthalene-1,4-dione.
| Compound Name | 5,6,7,8-tetrafluoro-2,3-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 52918191 |
| Molecular Formula | C12H6F4O4 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 5,6,7,8-tetrafluoro-2,3-dimethoxynaphthalene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)c2c(F)c(F)c(F)c(F)c2C1=O |
| InChI | InChI=1S/C12H6F4O4/c1-19-11-9(17)3-4(10(18)12(11)20-2)6(14)8(16)7(15)5(3)13/h1-2H3 |
| InChIKey | RWFZTHGRYHZHKJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|