About 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine
7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine (PubChem CID 52918390) has the molecular formula C21H18N6S
and a molecular weight of 386.48 g/mol. Its IUPAC name is 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine |
| PubChem CID | 52918390 |
| Molecular Formula | C21H18N6S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine |
| SMILES | Cc1cc2nc(-c3cccs3)n(-c3ccc4c(N)nc(N)nc4c3)c2cc1C |
| InChI | InChI=1S/C21H18N6S/c1-11-8-16-17(9-12(11)2)27(20(24-16)18-4-3-7-28-18)13-5-6-14-15(10-13)25-21(23)26-19(14)22/h3-10H,1-2H3,(H4,22,23,25,26) |
| InChIKey | SVQAULWAXASJJB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine?
The IUPAC name of 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine (CID 52918390) is 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine.
What is the SMILES notation for 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine?
The canonical SMILES for 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine is Cc1cc2nc(-c3cccs3)n(-c3ccc4c(N)nc(N)nc4c3)c2cc1C.
What is the InChIKey of 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine?
The InChIKey is SVQAULWAXASJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N6S/c1-11-8-16-17(9-12(11)2)27(20(24-16)18-4-3-7-28-18)13-5-6-14-15(10-13)25-21(23)26-19(14)22/h3-10H,1-2H3,(H4,22,23,25,26).
What are the key properties of 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine?
7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine has a molecular weight of 386.48 g/mol, XLogP of 4.48, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)quinazoline-2,4-diamine is sourced from PubChem (CID 52918390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).