About 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide
5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide (PubChem CID 52918685) has the molecular formula C20H23ClN2O
and a molecular weight of 342.87 g/mol. Its IUPAC name is 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide.
Molecular Properties
| Compound Name | 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide |
| PubChem CID | 52918685 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide |
| SMILES | NC(=O)CCCCN[C@@H]1C[C@H]1c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H23ClN2O/c21-17-10-8-15(9-11-17)14-4-6-16(7-5-14)18-13-19(18)23-12-2-1-3-20(22)24/h4-11,18-19,23H,1-3,12-13H2,(H2,22,24)/t18-,19+/m0/s1 |
| InChIKey | DGMNKZRIAYDYPG-RBUKOAKNSA-N |
| XLogP | 4.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide?
The IUPAC name of 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide (CID 52918685) is 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide.
What is the SMILES notation for 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide?
The canonical SMILES for 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide is NC(=O)CCCCN[C@@H]1C[C@H]1c1ccc(-c2ccc(Cl)cc2)cc1.
What is the InChIKey of 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide?
The InChIKey is DGMNKZRIAYDYPG-RBUKOAKNSA-N. The full InChI is InChI=1S/C20H23ClN2O/c21-17-10-8-15(9-11-17)14-4-6-16(7-5-14)18-13-19(18)23-12-2-1-3-20(22)24/h4-11,18-19,23H,1-3,12-13H2,(H2,22,24)/t18-,19+/m0/s1.
What are the key properties of 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide?
5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide has a molecular weight of 342.87 g/mol, XLogP of 4.11, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1R,2S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]amino]pentanamide is sourced from PubChem (CID 52918685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).