About dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate
dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate (PubChem CID 5291879) has the molecular formula C22H22O5
and a molecular weight of 366.41 g/mol. Its IUPAC name is dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate |
| PubChem CID | 5291879 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(c2ccccc2)CC(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C22H22O5/c1-26-20(24)22(21(25)27-2)18(15-9-5-3-6-10-15)13-17(23)14-19(22)16-11-7-4-8-12-16/h3-12,18-19H,13-14H2,1-2H3 |
| InChIKey | FTUPPKXMEXHVCD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate?
The IUPAC name of dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate (CID 5291879) is dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate.
What is the SMILES notation for dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate?
The canonical SMILES for dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate is COC(=O)C1(C(=O)OC)C(c2ccccc2)CC(=O)CC1c1ccccc1.
What is the InChIKey of dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate?
The InChIKey is FTUPPKXMEXHVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O5/c1-26-20(24)22(21(25)27-2)18(15-9-5-3-6-10-15)13-17(23)14-19(22)16-11-7-4-8-12-16/h3-12,18-19H,13-14H2,1-2H3.
What are the key properties of dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate?
dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate has a molecular weight of 366.41 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate is sourced from PubChem (CID 5291879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).