C22H20F3N5O2 — CID 52919148
1-[5-[4-[(cyclopropylmethylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 52919148) has the molecular formula C22H20F3N5O2 and a molecular weight of 443.43 g/mol. Its IUPAC name is 1-[5-[4-[(cyclopropylmethylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-[5-[4-[(cyclopropylmethylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 52919148 |
| Molecular Formula | C22H20F3N5O2 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-[5-[4-[(cyclopropylmethylamino)methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1ncc(-c2ccc(CNCC3CC3)cc2)c(=O)[nH]1)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H20F3N5O2/c23-16-7-18(25)19(8-17(16)24)28-22(32)30-21-27-11-15(20(31)29-21)14-5-3-13(4-6-14)10-26-9-12-1-2-12/h3-8,11-12,26H,1-2,9-10H2,(H3,27,28,29,30,31,32) |
| InChIKey | ADBPJNJWMURDTL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|